 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 54Asarone |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-08-17 04:21 |
| |
 |
|
|
| Synonyms |
|
| Formal Name |
1,2,4-trimethoxy-5-(1E)-1-propen-1-yl-benzene |
| CAS Number |
2883-98-9 |
| Molecular Formula |
C12H16O3
|
| Formula Weight |
208.3 |
| Formulation |
A crystalline solid |
| Purity |
≥98% |
| λmax
|
212, 258, 313 nm |
| Stability |
2 years |
| Storage |
-20°C |
| Shipping |
Wet ice in continental US; may vary elsewhere |
| SMILES |
COC1=CC(/C=C/C)=C(OC)C=C1OC |
|
|
